C18H18N2O2S — CID 17034710
[4-[3-(3,5-dimethylphenoxy)propanoylamino]phenyl] thiocyanate (PubChem CID 17034710) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is [4-[3-(3,5-dimethylphenoxy)propanoylamino]phenyl] thiocyanate.
| Compound Name | [4-[3-(3,5-dimethylphenoxy)propanoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 17034710 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [4-[3-(3,5-dimethylphenoxy)propanoylamino]phenyl] thiocyanate |
| SMILES | Cc1cc(C)cc(OCCC(=O)Nc2ccc(SC#N)cc2)c1 |
| InChI | InChI=1S/C18H18N2O2S/c1-13-9-14(2)11-16(10-13)22-8-7-18(21)20-15-3-5-17(6-4-15)23-12-19/h3-6,9-11H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | TXCQWUAQOAQKNS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|