C21H19ClF3N5O4 — CID 170347436
4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide (PubChem CID 170347436) has the molecular formula C21H19ClF3N5O4 and a molecular weight of 497.86 g/mol. Its IUPAC name is 4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 170347436 |
| Molecular Formula | C21H19ClF3N5O4 |
| Molecular Weight | 497.86 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-N-[4-(trifluoromethoxy)phenyl]piperidine-1-carboxamide |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(C(=O)Nc3ccc(OC(F)(F)F)cc3)CC2)c2ncc(Cl)cc21 |
| InChI | InChI=1S/C21H19ClF3N5O4/c1-28-16-10-12(22)11-26-17(16)30(19(32)18(28)31)14-6-8-29(9-7-14)20(33)27-13-2-4-15(5-3-13)34-21(23,24)25/h2-5,10-11,14H,6-9H2,1H3,(H,27,33) |
| InChIKey | XPUHLGMPKOSUGZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|