C21H20ClF3N4O3 — CID 170347442
7-chloro-1-methyl-4-[4-[4-(trifluoromethoxy)anilino]cyclohexyl]pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 170347442) has the molecular formula C21H20ClF3N4O3 and a molecular weight of 468.86 g/mol. Its IUPAC name is 7-chloro-1-methyl-4-[4-[4-(trifluoromethoxy)anilino]cyclohexyl]pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 7-chloro-1-methyl-4-[4-[4-(trifluoromethoxy)anilino]cyclohexyl]pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 170347442 |
| Molecular Formula | C21H20ClF3N4O3 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 7-chloro-1-methyl-4-[4-[4-(trifluoromethoxy)anilino]cyclohexyl]pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCC(Nc3ccc(OC(F)(F)F)cc3)CC2)c2ncc(Cl)cc21 |
| InChI | InChI=1S/C21H20ClF3N4O3/c1-28-17-10-12(22)11-26-18(17)29(20(31)19(28)30)15-6-2-13(3-7-15)27-14-4-8-16(9-5-14)32-21(23,24)25/h4-5,8-11,13,15,27H,2-3,6-7H2,1H3 |
| InChIKey | LOIRAXZYYBODIK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|