C16H19ClN4O4 — CID 170347554
(2R,5S)-4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-2,5-dimethylpiperidine-1-carboxylic acid (PubChem CID 170347554) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is (2R,5S)-4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-2,5-dimethylpiperidine-1-carboxylic acid.
| Compound Name | (2R,5S)-4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-2,5-dimethylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170347554 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2R,5S)-4-(7-chloro-1-methyl-2,3-dioxopyrido[2,3-b]pyrazin-4-yl)-2,5-dimethylpiperidine-1-carboxylic acid |
| SMILES | C[C@@H]1CC(n2c(=O)c(=O)n(C)c3cc(Cl)cnc32)[C@@H](C)CN1C(=O)O |
| InChI | InChI=1S/C16H19ClN4O4/c1-8-7-20(16(24)25)9(2)4-11(8)21-13-12(5-10(17)6-18-13)19(3)14(22)15(21)23/h5-6,8-9,11H,4,7H2,1-3H3,(H,24,25)/t8-,9+,11?/m0/s1 |
| InChIKey | PUYYLOMFAPMXIG-VUHGHZMFSA-N |
| XLogP | 1.70 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|