C24H32F2N5O3+ — CID 170349731
N-[4-amino-2-(dimethylamino)-5-[(4-hydroxy-4-methylcyclohexyl)iminomethyl]phenyl]-6-(1,1-difluoroethyl)-1-hydroxypyridin-1-ium-2-carboxamide (PubChem CID 170349731) has the molecular formula C24H32F2N5O3+ and a molecular weight of 476.55 g/mol. Its IUPAC name is N-[4-amino-2-(dimethylamino)-5-[(4-hydroxy-4-methylcyclohexyl)iminomethyl]phenyl]-6-(1,1-difluoroethyl)-1-hydroxypyridin-1-ium-2-carboxamide.
| Compound Name | N-[4-amino-2-(dimethylamino)-5-[(4-hydroxy-4-methylcyclohexyl)iminomethyl]phenyl]-6-(1,1-difluoroethyl)-1-hydroxypyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 170349731 |
| Molecular Formula | C24H32F2N5O3+ |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[4-amino-2-(dimethylamino)-5-[(4-hydroxy-4-methylcyclohexyl)iminomethyl]phenyl]-6-(1,1-difluoroethyl)-1-hydroxypyridin-1-ium-2-carboxamide |
| SMILES | CN(C)c1cc(N)c(/C=N/C2CCC(C)(O)CC2)cc1NC(=O)c1cccc(C(C)(F)F)[n+]1O |
| InChI | InChI=1S/C24H31F2N5O3/c1-23(33)10-8-16(9-11-23)28-14-15-12-18(20(30(3)4)13-17(15)27)29-22(32)19-6-5-7-21(31(19)34)24(2,25)26/h5-7,12-14,16,27,32-34H,8-11H2,1-4H3/p+1/b28-14+ |
| InChIKey | BJLXRDVWLOOXBB-CCVNUDIWSA-O |
| XLogP | 3.34 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|