About 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine
3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine (PubChem CID 170350072) has the molecular formula C11H13ClN4S
and a molecular weight of 268.77 g/mol. Its IUPAC name is 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine |
| PubChem CID | 170350072 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine |
| SMILES | Cc1c(N2CCNCC2)sc2nnc(Cl)cc12 |
| InChI | InChI=1S/C11H13ClN4S/c1-7-8-6-9(12)14-15-10(8)17-11(7)16-4-2-13-3-5-16/h6,13H,2-5H2,1H3 |
| InChIKey | HXFVEPNNXPAEMX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine?
The IUPAC name of 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine (CID 170350072) is 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine.
What is the SMILES notation for 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine?
The canonical SMILES for 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine is Cc1c(N2CCNCC2)sc2nnc(Cl)cc12.
What is the InChIKey of 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine?
The InChIKey is HXFVEPNNXPAEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN4S/c1-7-8-6-9(12)14-15-10(8)17-11(7)16-4-2-13-3-5-16/h6,13H,2-5H2,1H3.
What are the key properties of 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine?
3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine has a molecular weight of 268.77 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-methyl-6-piperazin-1-ylthieno[2,3-c]pyridazine is sourced from PubChem (CID 170350072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).