About 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide
4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide (PubChem CID 17035019) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide.
Molecular Properties
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide |
| PubChem CID | 17035019 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide |
| SMILES | CCCNC(=O)CCCN1C(=O)CCC1=O |
| InChI | InChI=1S/C11H18N2O3/c1-2-7-12-9(14)4-3-8-13-10(15)5-6-11(13)16/h2-8H2,1H3,(H,12,14) |
| InChIKey | HKDKBDBAISNQTA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide?
The IUPAC name of 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide (CID 17035019) is 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide.
What is the SMILES notation for 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide?
The canonical SMILES for 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide is CCCNC(=O)CCCN1C(=O)CCC1=O.
What is the InChIKey of 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide?
The InChIKey is HKDKBDBAISNQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-2-7-12-9(14)4-3-8-13-10(15)5-6-11(13)16/h2-8H2,1H3,(H,12,14).
What are the key properties of 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide?
4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide has a molecular weight of 226.28 g/mol, XLogP of 0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrolidin-1-yl)-N-propylbutanamide is sourced from PubChem (CID 17035019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).