About 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene
2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene (PubChem CID 170351002) has the molecular formula C21H24O2
and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene.
Molecular Properties
| Compound Name | 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene |
| PubChem CID | 170351002 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene |
| SMILES | COc1cc(/C=C/c2ccccc2)cc(OC)c1C1CCCC1 |
| InChI | InChI=1S/C21H24O2/c1-22-19-14-17(13-12-16-8-4-3-5-9-16)15-20(23-2)21(19)18-10-6-7-11-18/h3-5,8-9,12-15,18H,6-7,10-11H2,1-2H3/b13-12+ |
| InChIKey | KJSXHQHEMQXTLP-OUKQBFOZSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene?
The IUPAC name of 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene (CID 170351002) is 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene.
What is the SMILES notation for 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene?
The canonical SMILES for 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene is COc1cc(/C=C/c2ccccc2)cc(OC)c1C1CCCC1.
What is the InChIKey of 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene?
The InChIKey is KJSXHQHEMQXTLP-OUKQBFOZSA-N. The full InChI is InChI=1S/C21H24O2/c1-22-19-14-17(13-12-16-8-4-3-5-9-16)15-20(23-2)21(19)18-10-6-7-11-18/h3-5,8-9,12-15,18H,6-7,10-11H2,1-2H3/b13-12+.
What are the key properties of 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene?
2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene has a molecular weight of 308.42 g/mol, XLogP of 5.53, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene is sourced from PubChem (CID 170351002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).