About 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide
11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide (PubChem CID 17035156) has the molecular formula C22H32N2O3
and a molecular weight of 372.51 g/mol. Its IUPAC name is 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide.
Molecular Properties
| Compound Name | 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide |
| PubChem CID | 17035156 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide |
| SMILES | CN(C(=O)CCCCCCCCCCN1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O3/c1-23(19-13-9-8-10-14-19)20(25)15-11-6-4-2-3-5-7-12-18-24-21(26)16-17-22(24)27/h8-10,13-14H,2-7,11-12,15-18H2,1H3 |
| InChIKey | KUDFIFMUYBKIPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide?
The IUPAC name of 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide (CID 17035156) is 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide.
What is the SMILES notation for 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide?
The canonical SMILES for 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide is CN(C(=O)CCCCCCCCCCN1C(=O)CCC1=O)c1ccccc1.
What is the InChIKey of 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide?
The InChIKey is KUDFIFMUYBKIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N2O3/c1-23(19-13-9-8-10-14-19)20(25)15-11-6-4-2-3-5-7-12-18-24-21(26)16-17-22(24)27/h8-10,13-14H,2-7,11-12,15-18H2,1H3.
What are the key properties of 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide?
11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide has a molecular weight of 372.51 g/mol, XLogP of 4.31, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(2,5-dioxopyrrolidin-1-yl)-N-methyl-N-phenylundecanamide is sourced from PubChem (CID 17035156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).