About [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate
[2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate (PubChem CID 17035238) has the molecular formula C15H15BrN2O3S
and a molecular weight of 383.27 g/mol. Its IUPAC name is [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate.
Molecular Properties
| Compound Name | [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate |
| PubChem CID | 17035238 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate |
| SMILES | CCC(=O)Oc1cs/c(=N\c2ccccc2Br)n1C(=O)CC |
| InChI | InChI=1S/C15H15BrN2O3S/c1-3-12(19)18-13(21-14(20)4-2)9-22-15(18)17-11-8-6-5-7-10(11)16/h5-9H,3-4H2,1-2H3/b17-15- |
| InChIKey | JATRGQGZIBNPAQ-ICFOKQHNSA-N |
| XLogP | 3.91 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate?
The IUPAC name of [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate (CID 17035238) is [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate.
What is the SMILES notation for [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate?
The canonical SMILES for [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate is CCC(=O)Oc1cs/c(=N\c2ccccc2Br)n1C(=O)CC.
What is the InChIKey of [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate?
The InChIKey is JATRGQGZIBNPAQ-ICFOKQHNSA-N. The full InChI is InChI=1S/C15H15BrN2O3S/c1-3-12(19)18-13(21-14(20)4-2)9-22-15(18)17-11-8-6-5-7-10(11)16/h5-9H,3-4H2,1-2H3/b17-15-.
What are the key properties of [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate?
[2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate has a molecular weight of 383.27 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromophenyl)imino-3-propanoyl-1,3-thiazol-4-yl] propanoate is sourced from PubChem (CID 17035238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).