C10H16N4O — CID 170352627
3,4-dimethyl-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepine-2-carboxamide (PubChem CID 170352627) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 3,4-dimethyl-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepine-2-carboxamide.
| Compound Name | 3,4-dimethyl-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 170352627 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 3,4-dimethyl-5,6,7,8-tetrahydro-4H-pyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
| SMILES | Cc1c(C(N)=O)nn2c1C(C)NCCC2 |
| InChI | InChI=1S/C10H16N4O/c1-6-8(10(11)15)13-14-5-3-4-12-7(2)9(6)14/h7,12H,3-5H2,1-2H3,(H2,11,15) |
| InChIKey | JTMCSYBQWQZNCZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |