About [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate
[2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate (PubChem CID 17035295) has the molecular formula C17H19ClN2O3S
and a molecular weight of 366.87 g/mol. Its IUPAC name is [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate |
| PubChem CID | 17035295 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate |
| SMILES | CCC(=O)Oc1c(CC)s/c(=N\c2ccccc2Cl)n1C(=O)CC |
| InChI | InChI=1S/C17H19ClN2O3S/c1-4-13-16(23-15(22)6-3)20(14(21)5-2)17(24-13)19-12-10-8-7-9-11(12)18/h7-10H,4-6H2,1-3H3/b19-17- |
| InChIKey | UCXVEXIORCHCAR-ZPHPHTNESA-N |
| XLogP | 4.36 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate?
The IUPAC name of [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate (CID 17035295) is [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate.
What is the SMILES notation for [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate?
The canonical SMILES for [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate is CCC(=O)Oc1c(CC)s/c(=N\c2ccccc2Cl)n1C(=O)CC.
What is the InChIKey of [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate?
The InChIKey is UCXVEXIORCHCAR-ZPHPHTNESA-N. The full InChI is InChI=1S/C17H19ClN2O3S/c1-4-13-16(23-15(22)6-3)20(14(21)5-2)17(24-13)19-12-10-8-7-9-11(12)18/h7-10H,4-6H2,1-3H3/b19-17-.
What are the key properties of [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate?
[2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate has a molecular weight of 366.87 g/mol, XLogP of 4.36, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)imino-5-ethyl-3-propanoyl-1,3-thiazol-4-yl] propanoate is sourced from PubChem (CID 17035295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).