About 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one
2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one (PubChem CID 170353554) has the molecular formula C11H18F2N2O
and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one.
Molecular Properties
| Compound Name | 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one |
| PubChem CID | 170353554 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one |
| SMILES | CCCCC1=NC(CCF)(CCF)C(=O)N1 |
| InChI | InChI=1S/C11H18F2N2O/c1-2-3-4-9-14-10(16)11(15-9,5-7-12)6-8-13/h2-8H2,1H3,(H,14,15,16) |
| InChIKey | PLCYLVWJXZGCNS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one?
The IUPAC name of 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one (CID 170353554) is 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one.
What is the SMILES notation for 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one?
The canonical SMILES for 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one is CCCCC1=NC(CCF)(CCF)C(=O)N1.
What is the InChIKey of 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one?
The InChIKey is PLCYLVWJXZGCNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2O/c1-2-3-4-9-14-10(16)11(15-9,5-7-12)6-8-13/h2-8H2,1H3,(H,14,15,16).
What are the key properties of 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one?
2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one has a molecular weight of 232.27 g/mol, XLogP of 2.16, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4,4-bis(2-fluoroethyl)-1H-imidazol-5-one is sourced from PubChem (CID 170353554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).