About 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol
2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol (PubChem CID 170353671) has the molecular formula C11H20F2N2O
and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol.
Molecular Properties
| Compound Name | 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol |
| PubChem CID | 170353671 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol |
| SMILES | CCCCC1=NC(O)C(CCF)(CCF)N1 |
| InChI | InChI=1S/C11H20F2N2O/c1-2-3-4-9-14-10(16)11(15-9,5-7-12)6-8-13/h10,16H,2-8H2,1H3,(H,14,15) |
| InChIKey | ATQCRSUXZOIJSY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol?
The IUPAC name of 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol (CID 170353671) is 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol.
What is the SMILES notation for 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol?
The canonical SMILES for 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol is CCCCC1=NC(O)C(CCF)(CCF)N1.
What is the InChIKey of 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol?
The InChIKey is ATQCRSUXZOIJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O/c1-2-3-4-9-14-10(16)11(15-9,5-7-12)6-8-13/h10,16H,2-8H2,1H3,(H,14,15).
What are the key properties of 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol?
2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol has a molecular weight of 234.29 g/mol, XLogP of 1.95, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-5,5-bis(2-fluoroethyl)-1,4-dihydroimidazol-4-ol is sourced from PubChem (CID 170353671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).