About 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one
3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one (PubChem CID 17035460) has the molecular formula C22H21ClFN3O
and a molecular weight of 397.88 g/mol. Its IUPAC name is 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one.
Molecular Properties
| Compound Name | 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one |
| PubChem CID | 17035460 |
| Molecular Formula | C22H21ClFN3O |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one |
| SMILES | Cc1ccc(Nc2nn(-c3ccc(F)cc3)c3c2C(=O)CC(C)(C)C3)cc1Cl |
| InChI | InChI=1S/C22H21ClFN3O/c1-13-4-7-15(10-17(13)23)25-21-20-18(11-22(2,3)12-19(20)28)27(26-21)16-8-5-14(24)6-9-16/h4-10H,11-12H2,1-3H3,(H,25,26) |
| InChIKey | BQJLHYYAFZEVKY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one?
The IUPAC name of 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one (CID 17035460) is 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one.
What is the SMILES notation for 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one?
The canonical SMILES for 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one is Cc1ccc(Nc2nn(-c3ccc(F)cc3)c3c2C(=O)CC(C)(C)C3)cc1Cl.
What is the InChIKey of 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one?
The InChIKey is BQJLHYYAFZEVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClFN3O/c1-13-4-7-15(10-17(13)23)25-21-20-18(11-22(2,3)12-19(20)28)27(26-21)16-8-5-14(24)6-9-16/h4-10H,11-12H2,1-3H3,(H,25,26).
What are the key properties of 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one?
3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one has a molecular weight of 397.88 g/mol, XLogP of 5.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-4-methylanilino)-1-(4-fluorophenyl)-6,6-dimethyl-5,7-dihydroindazol-4-one is sourced from PubChem (CID 17035460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).