About 7-chlorotetrazolo[5,1-a]phthalazine
7-chlorotetrazolo[5,1-a]phthalazine (PubChem CID 170354928) has the molecular formula C8H4ClN5
and a molecular weight of 205.61 g/mol. Its IUPAC name is 7-chlorotetrazolo[5,1-a]phthalazine.
Molecular Properties
| Compound Name | 7-chlorotetrazolo[5,1-a]phthalazine |
| PubChem CID | 170354928 |
| Molecular Formula | C8H4ClN5 |
| Molecular Weight | 205.61 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 7-chlorotetrazolo[5,1-a]phthalazine |
| SMILES | Clc1cccc2c1cnn1nnnc21 |
| InChI | InChI=1S/C8H4ClN5/c9-7-3-1-2-5-6(7)4-10-14-8(5)11-12-13-14/h1-4H |
| InChIKey | MPBPRHIXULMOJF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.61 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chlorotetrazolo[5,1-a]phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chlorotetrazolo[5,1-a]phthalazine?
The IUPAC name of 7-chlorotetrazolo[5,1-a]phthalazine (CID 170354928) is 7-chlorotetrazolo[5,1-a]phthalazine.
What is the SMILES notation for 7-chlorotetrazolo[5,1-a]phthalazine?
The canonical SMILES for 7-chlorotetrazolo[5,1-a]phthalazine is Clc1cccc2c1cnn1nnnc21.
What is the InChIKey of 7-chlorotetrazolo[5,1-a]phthalazine?
The InChIKey is MPBPRHIXULMOJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClN5/c9-7-3-1-2-5-6(7)4-10-14-8(5)11-12-13-14/h1-4H.
What are the key properties of 7-chlorotetrazolo[5,1-a]phthalazine?
7-chlorotetrazolo[5,1-a]phthalazine has a molecular weight of 205.61 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chlorotetrazolo[5,1-a]phthalazine is sourced from PubChem (CID 170354928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).