C25H40N2 — CID 170354967
1-N'-propan-2-yl-1-N-[(3E)-3,4,5-trimethylhepta-1,3,6-trien-2-yl]-1-N'-[(3E,5Z)-2,3,5-trimethylhepta-1,3,5-trien-4-yl]ethene-1,1-diamine (PubChem CID 170354967) has the molecular formula C25H40N2 and a molecular weight of 368.61 g/mol. Its IUPAC name is 1-N'-propan-2-yl-1-N-[(3E)-3,4,5-trimethylhepta-1,3,6-trien-2-yl]-1-N'-[(3E,5Z)-2,3,5-trimethylhepta-1,3,5-trien-4-yl]ethene-1,1-diamine.
| Compound Name | 1-N'-propan-2-yl-1-N-[(3E)-3,4,5-trimethylhepta-1,3,6-trien-2-yl]-1-N'-[(3E,5Z)-2,3,5-trimethylhepta-1,3,5-trien-4-yl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 170354967 |
| Molecular Formula | C25H40N2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | 1-N'-propan-2-yl-1-N-[(3E)-3,4,5-trimethylhepta-1,3,6-trien-2-yl]-1-N'-[(3E,5Z)-2,3,5-trimethylhepta-1,3,5-trien-4-yl]ethene-1,1-diamine |
| SMILES | C=CC(C)/C(C)=C(\C)C(=C)NC(=C)N(C(/C(C)=C\C)=C(/C)C(=C)C)C(C)C |
| InChI | InChI=1S/C25H40N2/c1-14-18(7)21(10)22(11)23(12)26-24(13)27(17(5)6)25(19(8)15-2)20(9)16(3)4/h14-15,17-18,26H,1,3,12-13H2,2,4-11H3/b19-15-,22-21+,25-20+ |
| InChIKey | MCHNCQKPJANJRD-NSQMJPMZSA-N |
| XLogP | 7.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|