C19H16F3N5O4 — CID 170354969
[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone (PubChem CID 170354969) has the molecular formula C19H16F3N5O4 and a molecular weight of 435.36 g/mol. Its IUPAC name is [4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone.
| Compound Name | [4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
|---|---|
| PubChem CID | 170354969 |
| Molecular Formula | C19H16F3N5O4 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
| SMILES | CC(C)c1noc(C2=CCN(C(=O)c3noc(-c4cc(F)c(F)c(O)c4F)n3)CC2)n1 |
| InChI | InChI=1S/C19H16F3N5O4/c1-8(2)15-23-17(30-25-15)9-3-5-27(6-4-9)19(29)16-24-18(31-26-16)10-7-11(20)13(22)14(28)12(10)21/h3,7-8,28H,4-6H2,1-2H3 |
| InChIKey | PNDOGWGLHQOKRJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|