C17H16F3N3O4 — CID 170354978
6-oxa-9-azaspiro[4.5]decan-9-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone (PubChem CID 170354978) has the molecular formula C17H16F3N3O4 and a molecular weight of 383.33 g/mol. Its IUPAC name is 6-oxa-9-azaspiro[4.5]decan-9-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone.
| Compound Name | 6-oxa-9-azaspiro[4.5]decan-9-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
|---|---|
| PubChem CID | 170354978 |
| Molecular Formula | C17H16F3N3O4 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 6-oxa-9-azaspiro[4.5]decan-9-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
| SMILES | O=C(c1noc(-c2cc(F)c(F)c(O)c2F)n1)N1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H16F3N3O4/c18-10-7-9(11(19)13(24)12(10)20)15-21-14(22-27-15)16(25)23-5-6-26-17(8-23)3-1-2-4-17/h7,24H,1-6,8H2 |
| InChIKey | IBNASDPHFMCIOE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|