C17H18F3N3O4 — CID 170355003
[2-(2-methylpropyl)morpholin-4-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone (PubChem CID 170355003) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is [2-(2-methylpropyl)morpholin-4-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone.
| Compound Name | [2-(2-methylpropyl)morpholin-4-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
|---|---|
| PubChem CID | 170355003 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [2-(2-methylpropyl)morpholin-4-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
| SMILES | CC(C)CC1CN(C(=O)c2noc(-c3cc(F)c(F)c(O)c3F)n2)CCO1 |
| InChI | InChI=1S/C17H18F3N3O4/c1-8(2)5-9-7-23(3-4-26-9)17(25)15-21-16(27-22-15)10-6-11(18)13(20)14(24)12(10)19/h6,8-9,24H,3-5,7H2,1-2H3 |
| InChIKey | MOIZRMQWRXCIHJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|