C20H14ClF3N2O3 — CID 170355011
[3-(4-chlorophenyl)pyrrolidin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 170355011) has the molecular formula C20H14ClF3N2O3 and a molecular weight of 422.79 g/mol. Its IUPAC name is [3-(4-chlorophenyl)pyrrolidin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone.
| Compound Name | [3-(4-chlorophenyl)pyrrolidin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone |
|---|---|
| PubChem CID | 170355011 |
| Molecular Formula | C20H14ClF3N2O3 |
| Molecular Weight | 422.79 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | [3-(4-chlorophenyl)pyrrolidin-1-yl]-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | O=C(c1cc(-c2cc(F)c(F)c(O)c2F)on1)N1CCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H14ClF3N2O3/c21-12-3-1-10(2-4-12)11-5-6-26(9-11)20(28)15-8-16(29-25-15)13-7-14(22)18(24)19(27)17(13)23/h1-4,7-8,11,27H,5-6,9H2 |
| InChIKey | VOHYGFGPMMXBNT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.79 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|