C14H12F3N3O3 — CID 170355026
piperidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone (PubChem CID 170355026) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is piperidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone.
| Compound Name | piperidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
|---|---|
| PubChem CID | 170355026 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | piperidin-1-yl-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazol-3-yl]methanone |
| SMILES | O=C(c1noc(-c2cc(F)c(F)c(O)c2F)n1)N1CCCCC1 |
| InChI | InChI=1S/C14H12F3N3O3/c15-8-6-7(9(16)11(21)10(8)17)13-18-12(19-23-13)14(22)20-4-2-1-3-5-20/h6,21H,1-5H2 |
| InChIKey | OOJYBMNNYGKMCE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|