C43H43N3 — CID 170355441
(2S)-7-[[[(2S)-5-isoquinolin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]methyl]-N,N-dimethyl-5-naphthalen-1-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 170355441) has the molecular formula C43H43N3 and a molecular weight of 601.84 g/mol. Its IUPAC name is (2S)-7-[[[(2S)-5-isoquinolin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]methyl]-N,N-dimethyl-5-naphthalen-1-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-7-[[[(2S)-5-isoquinolin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]methyl]-N,N-dimethyl-5-naphthalen-1-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 170355441 |
| Molecular Formula | C43H43N3 |
| Molecular Weight | 601.84 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | (2S)-7-[[[(2S)-5-isoquinolin-5-yl-1,2,3,4-tetrahydronaphthalen-2-yl]-methylamino]methyl]-N,N-dimethyl-5-naphthalen-1-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CN(C)[C@H]1CCc2c(cc(CN(C)[C@H]3CCc4c(cccc4-c4cccc5cnccc45)C3)cc2-c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C43H43N3/c1-45(2)34-17-19-38-33(26-34)23-29(24-43(38)42-16-6-10-30-9-4-5-13-36(30)42)28-46(3)35-18-20-37-31(25-35)11-7-14-40(37)41-15-8-12-32-27-44-22-21-39(32)41/h4-16,21-24,27,34-35H,17-20,25-26,28H2,1-3H3/t34-,35-/m0/s1 |
| InChIKey | IHQPVHJNURXVEN-PXLJZGITSA-N |
| XLogP | 9.13 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.84 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |