About 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol
4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol (PubChem CID 170355718) has the molecular formula C16H14FNO4S
and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol |
| PubChem CID | 170355718 |
| Molecular Formula | C16H14FNO4S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol |
| SMILES | COc1cc(Oc2cc3sc(C)nc3cc2F)cc(OC)c1O |
| InChI | InChI=1S/C16H14FNO4S/c1-8-18-11-6-10(17)12(7-15(11)23-8)22-9-4-13(20-2)16(19)14(5-9)21-3/h4-7,19H,1-3H3 |
| InChIKey | HGNFYWNCRHMCFW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol?
The IUPAC name of 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol (CID 170355718) is 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol.
What is the SMILES notation for 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol?
The canonical SMILES for 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol is COc1cc(Oc2cc3sc(C)nc3cc2F)cc(OC)c1O.
What is the InChIKey of 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol?
The InChIKey is HGNFYWNCRHMCFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO4S/c1-8-18-11-6-10(17)12(7-15(11)23-8)22-9-4-13(20-2)16(19)14(5-9)21-3/h4-7,19H,1-3H3.
What are the key properties of 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol?
4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol has a molecular weight of 335.36 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-fluoro-2-methyl-1,3-benzothiazol-6-yl)oxy]-2,6-dimethoxyphenol is sourced from PubChem (CID 170355718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).