C35H49N5O5 — CID 170355927
(3R,6S)-6-[4-(dibenzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid (PubChem CID 170355927) has the molecular formula C35H49N5O5 and a molecular weight of 619.81 g/mol. Its IUPAC name is (3R,6S)-6-[4-(dibenzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid.
| Compound Name | (3R,6S)-6-[4-(dibenzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
|---|---|
| PubChem CID | 170355927 |
| Molecular Formula | C35H49N5O5 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | (3R,6S)-6-[4-(dibenzylamino)butyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylic acid |
| SMILES | CC(C)C[C@H]1ON(C(=O)O)C2CN(C3CCN(C)CC3)C(=O)[C@H](CCCCN(Cc3ccccc3)Cc3ccccc3)N2C1=O |
| InChI | InChI=1S/C35H49N5O5/c1-26(2)22-31-34(42)39-30(33(41)38(29-17-20-36(3)21-18-29)25-32(39)40(45-31)35(43)44)16-10-11-19-37(23-27-12-6-4-7-13-27)24-28-14-8-5-9-15-28/h4-9,12-15,26,29-32H,10-11,16-25H2,1-3H3,(H,43,44)/t30-,31+,32?/m0/s1 |
| InChIKey | FJJGXPFXQDIYKN-JGIBFQFJSA-N |
| XLogP | 4.66 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|