About 5,5-dibromoindole
5,5-dibromoindole (PubChem CID 170356637) has the molecular formula C8H5Br2N
and a molecular weight of 274.94 g/mol. Its IUPAC name is 5,5-dibromoindole.
Molecular Properties
| Compound Name | 5,5-dibromoindole |
| PubChem CID | 170356637 |
| Molecular Formula | C8H5Br2N |
| Molecular Weight | 274.94 g/mol |
| Exact Mass | 272.88 |
| IUPAC Name | 5,5-dibromoindole |
| SMILES | BrC1(Br)C=CC2=NC=CC2=C1 |
| InChI | InChI=1S/C8H5Br2N/c9-8(10)3-1-7-6(5-8)2-4-11-7/h1-5H |
| InChIKey | NFZHDAXJQTYZQK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dibromoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dibromoindole?
The IUPAC name of 5,5-dibromoindole (CID 170356637) is 5,5-dibromoindole.
What is the SMILES notation for 5,5-dibromoindole?
The canonical SMILES for 5,5-dibromoindole is BrC1(Br)C=CC2=NC=CC2=C1.
What is the InChIKey of 5,5-dibromoindole?
The InChIKey is NFZHDAXJQTYZQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br2N/c9-8(10)3-1-7-6(5-8)2-4-11-7/h1-5H.
What are the key properties of 5,5-dibromoindole?
5,5-dibromoindole has a molecular weight of 274.94 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dibromoindole is sourced from PubChem (CID 170356637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).