C9H15NO4 — CID 170356863
methyl 1,2-dihydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (PubChem CID 170356863) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is methyl 1,2-dihydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate.
| Compound Name | methyl 1,2-dihydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 170356863 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | methyl 1,2-dihydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| SMILES | COC(=O)C12CCCN1CC(O)C2O |
| InChI | InChI=1S/C9H15NO4/c1-14-8(13)9-3-2-4-10(9)5-6(11)7(9)12/h6-7,11-12H,2-5H2,1H3 |
| InChIKey | XJVVQQWQEVYNMG-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |