C11H19NO2 — CID 170356960
[1-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methanol (PubChem CID 170356960) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is [1-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methanol.
| Compound Name | [1-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methanol |
|---|---|
| PubChem CID | 170356960 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [1-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methanol |
| SMILES | OCC1(CN2CC3COCC3C2)CC1 |
| InChI | InChI=1S/C11H19NO2/c13-8-11(1-2-11)7-12-3-9-5-14-6-10(9)4-12/h9-10,13H,1-8H2 |
| InChIKey | DZCWIWUIIGHVEW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |