C12H22N2O2 — CID 170357050
(3S)-3-(hydroxymethyl)-N,N-dimethyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxamide (PubChem CID 170357050) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is (3S)-3-(hydroxymethyl)-N,N-dimethyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxamide.
| Compound Name | (3S)-3-(hydroxymethyl)-N,N-dimethyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxamide |
|---|---|
| PubChem CID | 170357050 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | (3S)-3-(hydroxymethyl)-N,N-dimethyl-1,2,3,5,6,7,8,8a-octahydroindolizine-7-carboxamide |
| SMILES | CN(C)C(=O)C1CCN2C(CC[C@H]2CO)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-13(2)12(16)9-5-6-14-10(7-9)3-4-11(14)8-15/h9-11,15H,3-8H2,1-2H3/t9?,10?,11-/m0/s1 |
| InChIKey | PUFCXHOJONWAJZ-ILDUYXDCSA-N |
| XLogP | 0.31 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |