C17H16ClF4N5O4S — CID 170357216
(1S,2R,5R)-2-[1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2,2-trifluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 170357216) has the molecular formula C17H16ClF4N5O4S and a molecular weight of 497.86 g/mol. Its IUPAC name is (1S,2R,5R)-2-[1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2,2-trifluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,2R,5R)-2-[1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2,2-trifluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 170357216 |
| Molecular Formula | C17H16ClF4N5O4S |
| Molecular Weight | 497.86 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | (1S,2R,5R)-2-[1-[(7-chloro-8-fluoro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]-2,2,2-trifluoroethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | CSc1nc2c(F)c(Cl)nc(OC([C@@H]3NC[C@H]4CC[C@@H]3N4C(=O)O)C(F)(F)F)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H16ClF4N5O4S/c1-32-15-24-10-7(13(28)26-15)14(25-12(18)8(10)19)31-11(17(20,21)22)9-6-3-2-5(4-23-9)27(6)16(29)30/h5-6,9,11,23H,2-4H2,1H3,(H,29,30)(H,24,26,28)/t5-,6+,9-,11?/m1/s1 |
| InChIKey | DNWYNZGTNMPXGE-CONTYOIASA-N |
| XLogP | 2.62 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|