C14H16F3NO7 — CID 170357258
4-(4-amino-3-methoxycarbonylphenoxy)butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 170357258) has the molecular formula C14H16F3NO7 and a molecular weight of 367.28 g/mol. Its IUPAC name is 4-(4-amino-3-methoxycarbonylphenoxy)butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(4-amino-3-methoxycarbonylphenoxy)butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170357258 |
| Molecular Formula | C14H16F3NO7 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-(4-amino-3-methoxycarbonylphenoxy)butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COC(=O)c1cc(OCCCC(=O)O)ccc1N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H15NO5.C2HF3O2/c1-17-12(16)9-7-8(4-5-10(9)13)18-6-2-3-11(14)15;3-2(4,5)1(6)7/h4-5,7H,2-3,6,13H2,1H3,(H,14,15);(H,6,7) |
| InChIKey | WDGDDVMZHHDORQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|