C17H19Cl2N5O4S — CID 170357309
(1S,2S,5R)-2-[1-[(7,8-dichloro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]ethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 170357309) has the molecular formula C17H19Cl2N5O4S and a molecular weight of 460.34 g/mol. Its IUPAC name is (1S,2S,5R)-2-[1-[(7,8-dichloro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]ethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | (1S,2S,5R)-2-[1-[(7,8-dichloro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]ethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 170357309 |
| Molecular Formula | C17H19Cl2N5O4S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | (1S,2S,5R)-2-[1-[(7,8-dichloro-2-methylsulfanyl-4-oxo-3H-pyrido[4,3-d]pyrimidin-5-yl)oxy]ethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | CSc1nc2c(Cl)c(Cl)nc(OC(C)[C@H]3NC[C@H]4CC[C@@H]3N4C(=O)O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C17H19Cl2N5O4S/c1-6(11-8-4-3-7(5-20-11)24(8)17(26)27)28-15-9-12(10(18)13(19)22-15)21-16(29-2)23-14(9)25/h6-8,11,20H,3-5H2,1-2H3,(H,26,27)(H,21,23,25)/t6?,7-,8+,11-/m1/s1 |
| InChIKey | ZAVZDNUCZIRWOV-IOCSBZMTSA-N |
| XLogP | 2.60 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|