C26H36N2O6S — CID 170357338
1-(4-butyl-N-sulfinoanilino)-2-methoxycarbonyl-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]benzene (PubChem CID 170357338) has the molecular formula C26H36N2O6S and a molecular weight of 504.65 g/mol. Its IUPAC name is 1-(4-butyl-N-sulfinoanilino)-2-methoxycarbonyl-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]benzene.
| Compound Name | 1-(4-butyl-N-sulfinoanilino)-2-methoxycarbonyl-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]benzene |
|---|---|
| PubChem CID | 170357338 |
| Molecular Formula | C26H36N2O6S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 1-(4-butyl-N-sulfinoanilino)-2-methoxycarbonyl-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]benzene |
| SMILES | CCCCc1ccc(N(c2ccc(NCCCC(=O)OC(C)(C)C)cc2C(=O)OC)S(=O)O)cc1 |
| InChI | InChI=1S/C26H36N2O6S/c1-6-7-9-19-11-14-21(15-12-19)28(35(31)32)23-16-13-20(18-22(23)25(30)33-5)27-17-8-10-24(29)34-26(2,3)4/h11-16,18,27H,6-10,17H2,1-5H3,(H,31,32) |
| InChIKey | HFHWKYKECDVEBQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|