C19H36OS — CID 170357383
(5E)-8,8-dimethyl-2,9,10-tri(propan-2-yl)-4,7,9,10-tetrahydro-1,3-oxathiecine (PubChem CID 170357383) has the molecular formula C19H36OS and a molecular weight of 312.56 g/mol. Its IUPAC name is (5E)-8,8-dimethyl-2,9,10-tri(propan-2-yl)-4,7,9,10-tetrahydro-1,3-oxathiecine.
| Compound Name | (5E)-8,8-dimethyl-2,9,10-tri(propan-2-yl)-4,7,9,10-tetrahydro-1,3-oxathiecine |
|---|---|
| PubChem CID | 170357383 |
| Molecular Formula | C19H36OS |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (5E)-8,8-dimethyl-2,9,10-tri(propan-2-yl)-4,7,9,10-tetrahydro-1,3-oxathiecine |
| SMILES | CC(C)C1OC(C(C)C)C(C(C)C)C(C)(C)C/C=C/CS1 |
| InChI | InChI=1S/C19H36OS/c1-13(2)16-17(14(3)4)20-18(15(5)6)21-12-10-9-11-19(16,7)8/h9-10,13-18H,11-12H2,1-8H3/b10-9+ |
| InChIKey | OEZAQEZHYMGQBJ-MDZDMXLPSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|