C18H34OS — CID 170357406
(6E)-10-butan-2-yl-8,8,9-trimethyl-2-propan-2-yl-4,5,9,10-tetrahydro-1,3-oxathiecine (PubChem CID 170357406) has the molecular formula C18H34OS and a molecular weight of 298.54 g/mol. Its IUPAC name is (6E)-10-butan-2-yl-8,8,9-trimethyl-2-propan-2-yl-4,5,9,10-tetrahydro-1,3-oxathiecine.
| Compound Name | (6E)-10-butan-2-yl-8,8,9-trimethyl-2-propan-2-yl-4,5,9,10-tetrahydro-1,3-oxathiecine |
|---|---|
| PubChem CID | 170357406 |
| Molecular Formula | C18H34OS |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (6E)-10-butan-2-yl-8,8,9-trimethyl-2-propan-2-yl-4,5,9,10-tetrahydro-1,3-oxathiecine |
| SMILES | CCC(C)C1OC(C(C)C)SCC/C=C/C(C)(C)C1C |
| InChI | InChI=1S/C18H34OS/c1-8-14(4)16-15(5)18(6,7)11-9-10-12-20-17(19-16)13(2)3/h9,11,13-17H,8,10,12H2,1-7H3/b11-9+ |
| InChIKey | ZXRKVQKNVRPZMF-PKNBQFBNSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|