C16H30OS — CID 170357667
(6Z)-10-butan-2-yl-9-methyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine (PubChem CID 170357667) has the molecular formula C16H30OS and a molecular weight of 270.48 g/mol. Its IUPAC name is (6Z)-10-butan-2-yl-9-methyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine.
| Compound Name | (6Z)-10-butan-2-yl-9-methyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
|---|---|
| PubChem CID | 170357667 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (6Z)-10-butan-2-yl-9-methyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
| SMILES | CCC(C)C1OC(C(C)C)SCC/C=C\CC1C |
| InChI | InChI=1S/C16H30OS/c1-6-13(4)15-14(5)10-8-7-9-11-18-16(17-15)12(2)3/h7-8,12-16H,6,9-11H2,1-5H3/b8-7- |
| InChIKey | IBYCRWADJKIZNU-FPLPWBNLSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|