C15H28OS — CID 170357722
(6Z)-10-butan-2-yl-2,8,9-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine (PubChem CID 170357722) has the molecular formula C15H28OS and a molecular weight of 256.45 g/mol. Its IUPAC name is (6Z)-10-butan-2-yl-2,8,9-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine.
| Compound Name | (6Z)-10-butan-2-yl-2,8,9-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
|---|---|
| PubChem CID | 170357722 |
| Molecular Formula | C15H28OS |
| Molecular Weight | 256.45 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (6Z)-10-butan-2-yl-2,8,9-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
| SMILES | CCC(C)C1OC(C)SCC/C=C\C(C)C1C |
| InChI | InChI=1S/C15H28OS/c1-6-11(2)15-13(4)12(3)9-7-8-10-17-14(5)16-15/h7,9,11-15H,6,8,10H2,1-5H3/b9-7- |
| InChIKey | BHDXXIIMAMHQIL-CLFYSBASSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|