C11H20OS — CID 170357794
(6Z)-2,9,10-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine (PubChem CID 170357794) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (6Z)-2,9,10-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine.
| Compound Name | (6Z)-2,9,10-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
|---|---|
| PubChem CID | 170357794 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (6Z)-2,9,10-trimethyl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
| SMILES | CC1OC(C)C(C)C/C=C\CCS1 |
| InChI | InChI=1S/C11H20OS/c1-9-7-5-4-6-8-13-11(3)12-10(9)2/h4-5,9-11H,6-8H2,1-3H3/b5-4- |
| InChIKey | DVTSYFVCNBTLKQ-PLNGDYQASA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|