C14H26OS — CID 170357826
(6Z)-8,9,10-trimethyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine (PubChem CID 170357826) has the molecular formula C14H26OS and a molecular weight of 242.43 g/mol. Its IUPAC name is (6Z)-8,9,10-trimethyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine.
| Compound Name | (6Z)-8,9,10-trimethyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
|---|---|
| PubChem CID | 170357826 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (6Z)-8,9,10-trimethyl-2-propan-2-yl-5,8,9,10-tetrahydro-4H-1,3-oxathiecine |
| SMILES | CC(C)C1OC(C)C(C)C(C)/C=C\CCS1 |
| InChI | InChI=1S/C14H26OS/c1-10(2)14-15-13(5)12(4)11(3)8-6-7-9-16-14/h6,8,10-14H,7,9H2,1-5H3/b8-6- |
| InChIKey | QNOIOFCSDHWEBR-VURMDHGXSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|