About (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene
(7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene (PubChem CID 170357844) has the molecular formula C16H30OS
and a molecular weight of 270.48 g/mol. Its IUPAC name is (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene.
Molecular Properties
| Compound Name | (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene |
| PubChem CID | 170357844 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene |
| SMILES | CC1OC(C(C)C)C(C(C)C)C/C=C\CCCS1 |
| InChI | InChI=1S/C16H30OS/c1-12(2)15-10-8-6-7-9-11-18-14(5)17-16(15)13(3)4/h6,8,12-16H,7,9-11H2,1-5H3/b8-6- |
| InChIKey | SAGSMSQBRKYHAX-VURMDHGXSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene?
The IUPAC name of (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene (CID 170357844) is (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene.
What is the SMILES notation for (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene?
The canonical SMILES for (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene is CC1OC(C(C)C)C(C(C)C)C/C=C\CCCS1.
What is the InChIKey of (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene?
The InChIKey is SAGSMSQBRKYHAX-VURMDHGXSA-N. The full InChI is InChI=1S/C16H30OS/c1-12(2)15-10-8-6-7-9-11-18-14(5)17-16(15)13(3)4/h6,8,12-16H,7,9-11H2,1-5H3/b8-6-.
What are the key properties of (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene?
(7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene has a molecular weight of 270.48 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-2-methyl-10,11-di(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene is sourced from PubChem (CID 170357844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).