About (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene
(7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene (PubChem CID 170357846) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene.
Molecular Properties
| Compound Name | (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene |
| PubChem CID | 170357846 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene |
| SMILES | CC(C)C1OC(C)C(C)C/C=C\CCCS1 |
| InChI | InChI=1S/C14H26OS/c1-11(2)14-15-13(4)12(3)9-7-5-6-8-10-16-14/h5,7,11-14H,6,8-10H2,1-4H3/b7-5- |
| InChIKey | WJUJMZAJEUDJTF-ALCCZGGFSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene?
The IUPAC name of (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene (CID 170357846) is (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene.
What is the SMILES notation for (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene?
The canonical SMILES for (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene is CC(C)C1OC(C)C(C)C/C=C\CCCS1.
What is the InChIKey of (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene?
The InChIKey is WJUJMZAJEUDJTF-ALCCZGGFSA-N. The full InChI is InChI=1S/C14H26OS/c1-11(2)14-15-13(4)12(3)9-7-5-6-8-10-16-14/h5,7,11-14H,6,8-10H2,1-4H3/b7-5-.
What are the key properties of (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene?
(7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene has a molecular weight of 242.43 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-10,11-dimethyl-2-propan-2-yl-1-oxa-3-thiacycloundec-7-ene is sourced from PubChem (CID 170357846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).