About (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol
(6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol (PubChem CID 170357968) has the molecular formula C10H11ClO3
and a molecular weight of 214.65 g/mol. Its IUPAC name is (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol.
Molecular Properties
| Compound Name | (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol |
| PubChem CID | 170357968 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol |
| SMILES | CC1COc2cc(CO)c(Cl)cc2O1 |
| InChI | InChI=1S/C10H11ClO3/c1-6-5-13-9-2-7(4-12)8(11)3-10(9)14-6/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | INCSWLMCFVBVTP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol?
The IUPAC name of (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol (CID 170357968) is (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol.
What is the SMILES notation for (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol?
The canonical SMILES for (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol is CC1COc2cc(CO)c(Cl)cc2O1.
What is the InChIKey of (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol?
The InChIKey is INCSWLMCFVBVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO3/c1-6-5-13-9-2-7(4-12)8(11)3-10(9)14-6/h2-3,6,12H,4-5H2,1H3.
What are the key properties of (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol?
(6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol has a molecular weight of 214.65 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxin-7-yl)methanol is sourced from PubChem (CID 170357968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).