C34H37F6NO2 — CID 170359581
(3S,8S)-3-[[1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl]oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170359581) has the molecular formula C34H37F6NO2 and a molecular weight of 605.66 g/mol. Its IUPAC name is (3S,8S)-3-[[1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl]oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3S,8S)-3-[[1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl]oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 170359581 |
| Molecular Formula | C34H37F6NO2 |
| Molecular Weight | 605.66 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | (3S,8S)-3-[[1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-yl]oxymethyl]-8-(trityloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CCCC(OC[C@@H]1CC[C@]2(COC(c3ccccc3)(c3ccccc3)c3ccccc3)CCCN12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C34H37F6NO2/c1-2-20-31(33(35,36)37,34(38,39)40)42-24-29-19-22-30(21-12-23-41(29)30)25-43-32(26-13-6-3-7-14-26,27-15-8-4-9-16-27)28-17-10-5-11-18-28/h3-11,13-18,29H,2,12,19-25H2,1H3/t29-,30-/m0/s1 |
| InChIKey | VYWZIIRUGWWGDQ-KYJUHHDHSA-N |
| XLogP | 8.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.66 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|