About N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine
N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine (PubChem CID 170359902) has the molecular formula C17H20FN
and a molecular weight of 257.35 g/mol. Its IUPAC name is N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine.
Molecular Properties
| Compound Name | N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine |
| PubChem CID | 170359902 |
| Molecular Formula | C17H20FN |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine |
| SMILES | C=C/C=C(\N=C(/C=C)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN/c1-6-8-15(13-9-11-14(18)12-10-13)19-16(7-2)17(3,4)5/h6-12H,1-2H2,3-5H3/b15-8-,19-16+ |
| InChIKey | WVDVAZPVMIHGPM-BLBMTREDSA-N |
| XLogP | 5.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine?
The IUPAC name of N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine (CID 170359902) is N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine.
What is the SMILES notation for N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine?
The canonical SMILES for N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine is C=C/C=C(\N=C(/C=C)C(C)(C)C)c1ccc(F)cc1.
What is the InChIKey of N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine?
The InChIKey is WVDVAZPVMIHGPM-BLBMTREDSA-N. The full InChI is InChI=1S/C17H20FN/c1-6-8-15(13-9-11-14(18)12-10-13)19-16(7-2)17(3,4)5/h6-12H,1-2H2,3-5H3/b15-8-,19-16+.
What are the key properties of N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine?
N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine has a molecular weight of 257.35 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-(4-fluorophenyl)buta-1,3-dienyl]-4,4-dimethylpent-1-en-3-imine is sourced from PubChem (CID 170359902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).