About 3,4-dihydro-2H-pyran-3,4-dithiol
3,4-dihydro-2H-pyran-3,4-dithiol (PubChem CID 170360269) has the molecular formula C5H8OS2
and a molecular weight of 148.25 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-3,4-dithiol.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-pyran-3,4-dithiol |
| PubChem CID | 170360269 |
| Molecular Formula | C5H8OS2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 3,4-dihydro-2H-pyran-3,4-dithiol |
| SMILES | SC1C=COCC1S |
| InChI | InChI=1S/C5H8OS2/c7-4-1-2-6-3-5(4)8/h1-2,4-5,7-8H,3H2 |
| InChIKey | MBLKHSXLCOVBPD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydro-2H-pyran-3,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-pyran-3,4-dithiol?
The IUPAC name of 3,4-dihydro-2H-pyran-3,4-dithiol (CID 170360269) is 3,4-dihydro-2H-pyran-3,4-dithiol.
What is the SMILES notation for 3,4-dihydro-2H-pyran-3,4-dithiol?
The canonical SMILES for 3,4-dihydro-2H-pyran-3,4-dithiol is SC1C=COCC1S.
What is the InChIKey of 3,4-dihydro-2H-pyran-3,4-dithiol?
The InChIKey is MBLKHSXLCOVBPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS2/c7-4-1-2-6-3-5(4)8/h1-2,4-5,7-8H,3H2.
What are the key properties of 3,4-dihydro-2H-pyran-3,4-dithiol?
3,4-dihydro-2H-pyran-3,4-dithiol has a molecular weight of 148.25 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-pyran-3,4-dithiol is sourced from PubChem (CID 170360269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).