About 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol
2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol (PubChem CID 170360346) has the molecular formula C5H8OS2
and a molecular weight of 148.25 g/mol. Its IUPAC name is 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol.
Molecular Properties
| Compound Name | 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol |
| PubChem CID | 170360346 |
| Molecular Formula | C5H8OS2 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol |
| SMILES | SCC1OC=CC1S |
| InChI | InChI=1S/C5H8OS2/c7-3-4-5(8)1-2-6-4/h1-2,4-5,7-8H,3H2 |
| InChIKey | RTFYSHHNAMKLTC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol?
The IUPAC name of 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol (CID 170360346) is 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol.
What is the SMILES notation for 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol?
The canonical SMILES for 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol is SCC1OC=CC1S.
What is the InChIKey of 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol?
The InChIKey is RTFYSHHNAMKLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS2/c7-3-4-5(8)1-2-6-4/h1-2,4-5,7-8H,3H2.
What are the key properties of 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol?
2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol has a molecular weight of 148.25 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(sulfanylmethyl)-2,3-dihydrofuran-3-thiol is sourced from PubChem (CID 170360346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).