C24H29IN2O6S — CID 170360694
benzyl N-[(1R,2S,4S)-2-[[3-(2-iodopropan-2-ylsulfonyl)phenyl]carbamoyl]-4-methoxycyclopentyl]carbamate (PubChem CID 170360694) has the molecular formula C24H29IN2O6S and a molecular weight of 600.48 g/mol. Its IUPAC name is benzyl N-[(1R,2S,4S)-2-[[3-(2-iodopropan-2-ylsulfonyl)phenyl]carbamoyl]-4-methoxycyclopentyl]carbamate.
| Compound Name | benzyl N-[(1R,2S,4S)-2-[[3-(2-iodopropan-2-ylsulfonyl)phenyl]carbamoyl]-4-methoxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 170360694 |
| Molecular Formula | C24H29IN2O6S |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | benzyl N-[(1R,2S,4S)-2-[[3-(2-iodopropan-2-ylsulfonyl)phenyl]carbamoyl]-4-methoxycyclopentyl]carbamate |
| SMILES | CO[C@H]1C[C@H](C(=O)Nc2cccc(S(=O)(=O)C(C)(C)I)c2)[C@H](NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C24H29IN2O6S/c1-24(2,25)34(30,31)19-11-7-10-17(12-19)26-22(28)20-13-18(32-3)14-21(20)27-23(29)33-15-16-8-5-4-6-9-16/h4-12,18,20-21H,13-15H2,1-3H3,(H,26,28)(H,27,29)/t18-,20-,21+/m0/s1 |
| InChIKey | VLNYJAYUPKSFQE-SESVDKBCSA-N |
| XLogP | 4.29 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|