C10H18N2 — CID 170360869
(1S,2S,5R)-2-[(E)-but-2-en-2-yl]-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170360869) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (1S,2S,5R)-2-[(E)-but-2-en-2-yl]-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | (1S,2S,5R)-2-[(E)-but-2-en-2-yl]-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170360869 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (1S,2S,5R)-2-[(E)-but-2-en-2-yl]-3,8-diazabicyclo[3.2.1]octane |
| SMILES | C/C=C(\C)[C@@H]1NC[C@H]2CC[C@@H]1N2 |
| InChI | InChI=1S/C10H18N2/c1-3-7(2)10-9-5-4-8(12-9)6-11-10/h3,8-12H,4-6H2,1-2H3/b7-3+/t8-,9+,10+/m1/s1 |
| InChIKey | MFEVGJYEEJXDLO-FLLRFSIRSA-N |
| XLogP | 1.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|