C43H32N2O5 — CID 170360872
6-[4-[2-[2-(N-methyl-4-phenylanilino)phenyl]carbazol-9-yl]phenyl]benzene-1,2,3,4,5-pentol (PubChem CID 170360872) has the molecular formula C43H32N2O5 and a molecular weight of 656.74 g/mol. Its IUPAC name is 6-[4-[2-[2-(N-methyl-4-phenylanilino)phenyl]carbazol-9-yl]phenyl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-[2-[2-(N-methyl-4-phenylanilino)phenyl]carbazol-9-yl]phenyl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 170360872 |
| Molecular Formula | C43H32N2O5 |
| Molecular Weight | 656.74 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | 6-[4-[2-[2-(N-methyl-4-phenylanilino)phenyl]carbazol-9-yl]phenyl]benzene-1,2,3,4,5-pentol |
| SMILES | CN(c1ccc(-c2ccccc2)cc1)c1ccccc1-c1ccc2c3ccccc3n(-c3ccc(-c4c(O)c(O)c(O)c(O)c4O)cc3)c2c1 |
| InChI | InChI=1S/C43H32N2O5/c1-44(30-20-15-27(16-21-30)26-9-3-2-4-10-26)35-13-7-5-11-32(35)29-19-24-34-33-12-6-8-14-36(33)45(37(34)25-29)31-22-17-28(18-23-31)38-39(46)41(48)43(50)42(49)40(38)47/h2-25,46-50H,1H3 |
| InChIKey | RVCJECCOCWGMDC-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.74 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|