About 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione
5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione (PubChem CID 170361369) has the molecular formula C28H26O6
and a molecular weight of 458.51 g/mol. Its IUPAC name is 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione |
| PubChem CID | 170361369 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C3(c4ccc5c(c4)C(=O)OC5=O)CCCCC4CC4CCCC3)ccc21 |
| InChI | InChI=1S/C28H26O6/c29-24-20-9-7-18(14-22(20)26(31)33-24)28(11-3-1-5-16-13-17(16)6-2-4-12-28)19-8-10-21-23(15-19)27(32)34-25(21)30/h7-10,14-17H,1-6,11-13H2 |
| InChIKey | NONWUEIIZQDXBB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione?
The IUPAC name of 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione (CID 170361369) is 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione.
What is the SMILES notation for 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione?
The canonical SMILES for 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione is O=C1OC(=O)c2cc(C3(c4ccc5c(c4)C(=O)OC5=O)CCCCC4CC4CCCC3)ccc21.
What is the InChIKey of 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione?
The InChIKey is NONWUEIIZQDXBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26O6/c29-24-20-9-7-18(14-22(20)26(31)33-24)28(11-3-1-5-16-13-17(16)6-2-4-12-28)19-8-10-21-23(15-19)27(32)34-25(21)30/h7-10,14-17H,1-6,11-13H2.
What are the key properties of 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione?
5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione has a molecular weight of 458.51 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(1,3-dioxo-2-benzofuran-5-yl)-6-bicyclo[9.1.0]dodecanyl]-2-benzofuran-1,3-dione is sourced from PubChem (CID 170361369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).